Products 933742-24-6

CAS 933742-24-6 is the registry number for 2-(Aminomethyl)thiazole-5-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

2-(aminomethyl)-1,3-thiazole-5-carboxylic acid (CAS 933742-24-6) is a chemical compound with the molecular formula C5H6N2O2S and a molecular weight of 158.18 g/mol. IUPAC name: 2-(aminomethyl)-1,3-thiazole-5-carboxylic acid. InChIKey: YEYCMJVDOVUXFX-UHFFFAOYSA-N.

Identity
Molecular formulaC5H6N2O2S
Molecular weight158.18 g/mol
IUPAC name2-(aminomethyl)-1,3-thiazole-5-carboxylic acid
InChIKeyYEYCMJVDOVUXFX-UHFFFAOYSA-N
SMILESC1=C(SC(=N1)CN)C(=O)O

Computed by PubChem (NCBI)