CAS 933949-52-1 is the registry number for N-(4-(4-amino-2-aza-3,4-dinitrilobuta-1,3-dienyl)phenyl)ethanamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-[4-[[(Z)-2-amino-1,2-dicyanoethenyl]iminomethyl]phenyl]acetamide (CAS 933949-52-1) is a chemical compound with the molecular formula C13H11N5O and a molecular weight of 253.26 g/mol. IUPAC name: N-[4-[[(Z)-2-amino-1,2-dicyanoethenyl]iminomethyl]phenyl]acetamide. InChIKey: QBIAFGPIWJRQQP-GCZOFJPHSA-N.
| Molecular formula | C13H11N5O |
|---|---|
| Molecular weight | 253.26 g/mol |
| IUPAC name | N-[4-[[(Z)-2-amino-1,2-dicyanoethenyl]iminomethyl]phenyl]acetamide |
| InChIKey | QBIAFGPIWJRQQP-GCZOFJPHSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)C=N/C(=C(/C#N)\N)/C#N |
Computed by PubChem (NCBI)