CAS 93396-89-5 is the registry number for Methyl 2-(Acetylamino)-6-azido-2,3,6-trideoxy-alpha-D-ribo-hexopyranoside. Offered by: TRC. Available pack sizes: 500mg.
N-[(2S,3R,5S,6R)-6-(azidomethyl)-5-hydroxy-2-methoxyoxan-3-yl]acetamide (CAS 93396-89-5) is a chemical compound with the molecular formula C9H16N4O4 and a molecular weight of 244.25 g/mol. IUPAC name: N-[(2S,3R,5S,6R)-6-(azidomethyl)-5-hydroxy-2-methoxyoxan-3-yl]acetamide. InChIKey: SRKDTDQRODIHDA-XAVMHZPKSA-N.
| Molecular formula | C9H16N4O4 |
|---|---|
| Molecular weight | 244.25 g/mol |
| IUPAC name | N-[(2S,3R,5S,6R)-6-(azidomethyl)-5-hydroxy-2-methoxyoxan-3-yl]acetamide |
| InChIKey | SRKDTDQRODIHDA-XAVMHZPKSA-N |
| SMILES | CC(=O)N[C@@H]1C[C@@H]([C@H](O[C@@H]1OC)CN=[N+]=[N-])O |
Computed by PubChem (NCBI)