CAS 933971-17-6 is the registry number for tert-Butyl 2-(4-oxo-4,5-dihydro-1,3-thiazol-2-yl)acetate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Tert-butyl 2-(4-oxo-1,3-thiazol-2-yl)acetate (CAS 933971-17-6) is a chemical compound with the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. IUPAC name: tert-butyl 2-(4-oxo-1,3-thiazol-2-yl)acetate. InChIKey: NBKKBCXVNGZSLG-UHFFFAOYSA-N.
| Molecular formula | C9H13NO3S |
|---|---|
| Molecular weight | 215.27 g/mol |
| IUPAC name | tert-butyl 2-(4-oxo-1,3-thiazol-2-yl)acetate |
| InChIKey | NBKKBCXVNGZSLG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC1=NC(=O)CS1 |
Computed by PubChem (NCBI)