Products 934-36-1

CAS 934-36-1 appears in our catalog under these names: 2H-1,3-Benzodithiole-2-thione, >95% (HPLC), 2H-1,3-Benzodithiole-2-thione, 2h-1,3-Benzodithiole-2-thione, 98%, 98%, 2h-1,3-Benzodithiole-2-thione, 98%. Offered by: TRC, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 500mg, 50mg, 2,5g, 1g, 100mg.

Structural formula: {0} (CAS {1})

1,3-benzodithiole-2-thione (CAS 934-36-1) is a chemical compound with the molecular formula C7H4S3 and a molecular weight of 184.3 g/mol. IUPAC name: 1,3-benzodithiole-2-thione. InChIKey: PTYIRFMMOVOESN-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4S3
Molecular weight184.3 g/mol
IUPAC name1,3-benzodithiole-2-thione
InChIKeyPTYIRFMMOVOESN-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)SC(=S)S2

Computed by PubChem (NCBI)