CAS 934107-83-2 is the registry number for 1-(Thiophene-2-sulfonyl)piperidin-3-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-thiophen-2-ylsulfonylpiperidin-3-amine (CAS 934107-83-2) is a chemical compound with the molecular formula C9H14N2O2S2 and a molecular weight of 246.4 g/mol. IUPAC name: 1-thiophen-2-ylsulfonylpiperidin-3-amine. InChIKey: LGSIMFKVBWAZMK-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2S2 |
|---|---|
| Molecular weight | 246.4 g/mol |
| IUPAC name | 1-thiophen-2-ylsulfonylpiperidin-3-amine |
| InChIKey | LGSIMFKVBWAZMK-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)S(=O)(=O)C2=CC=CS2)N |
Computed by PubChem (NCBI)