CAS 93413-00-4 appears in our catalog under these names: Chamaechromone, Chamaechromone, 99.75%. Offered by: TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 5 mg, 10 mg.
3-[1,1-bis(4-hydroxyphenyl)-3-oxo-3-(2,4,6-trihydroxyphenyl)propan-2-yl]-5,7-dihydroxychromen-4-one (CAS 93413-00-4) is a chemical compound with the molecular formula C30H22O10 and a molecular weight of 542.5 g/mol. IUPAC name: 3-[1,1-bis(4-hydroxyphenyl)-3-oxo-3-(2,4,6-trihydroxyphenyl)propan-2-yl]-5,7-dihydroxychromen-4-one. InChIKey: KLKLIUIRQAMTAJ-UHFFFAOYSA-N.
| Molecular formula | C30H22O10 |
|---|---|
| Molecular weight | 542.5 g/mol |
| IUPAC name | 3-[1,1-bis(4-hydroxyphenyl)-3-oxo-3-(2,4,6-trihydroxyphenyl)propan-2-yl]-5,7-dihydroxychromen-4-one |
| InChIKey | KLKLIUIRQAMTAJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C2=CC=C(C=C2)O)C(C3=COC4=CC(=CC(=C4C3=O)O)O)C(=O)C5=C(C=C(C=C5O)O)O)O |
Computed by PubChem (NCBI)