Products 934236-37-0

CAS 934236-37-0 is the registry number for 1-Methyl-1h-imidazole-2-sulfonyl fluoride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 100mg, 10g, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-methylimidazole-2-sulfonyl fluoride (CAS 934236-37-0) is a chemical compound with the molecular formula C4H5FN2O2S and a molecular weight of 164.16 g/mol. IUPAC name: 1-methylimidazole-2-sulfonyl fluoride. InChIKey: SNHGIVRTDYJPBU-UHFFFAOYSA-N.

Identity
Molecular formulaC4H5FN2O2S
Molecular weight164.16 g/mol
IUPAC name1-methylimidazole-2-sulfonyl fluoride
InChIKeySNHGIVRTDYJPBU-UHFFFAOYSA-N
SMILESCN1C=CN=C1S(=O)(=O)F

Computed by PubChem (NCBI)