Products 934295-48-4
CAS 934295-48-4 appears in our catalog under these names: Rabeprazole-d4, >95% (HPLC), Rabeprazole–d4, Rabeprazole-d4, 98.18%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 1mg, 5mg, 10 mg, 1 mg, 5 mg.
4,5,6,7-tetradeuterio-2-[[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfinyl]-1H-benzimidazole (CAS 934295-48-4) is a chemical compound with the molecular formula C18H21N3O3S and a molecular weight of 363.5 g/mol. IUPAC name: 4,5,6,7-tetradeuterio-2-[[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfinyl]-1H-benzimidazole. InChIKey: YREYEVIYCVEVJK-ZDPIWEEJSA-N.
| Molecular formula | C18H21N3O3S |
|---|---|
| Molecular weight | 363.5 g/mol |
| IUPAC name | 4,5,6,7-tetradeuterio-2-[[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfinyl]-1H-benzimidazole |
| InChIKey | YREYEVIYCVEVJK-ZDPIWEEJSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])NC(=N2)S(=O)CC3=NC=CC(=C3C)OCCCOC)[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
Rabeprazole-d4, Rabeprazole D4