CAS 93434-76-5 is the registry number for 2-Hydroxy-3-(3-phenylpropyl)-benzoic Acid. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 100mg, 50mg.
2-hydroxy-3-(3-phenylpropyl)benzoic acid (CAS 93434-76-5) is a chemical compound with the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. IUPAC name: 2-hydroxy-3-(3-phenylpropyl)benzoic acid. InChIKey: VPTXPMBNBZLRET-UHFFFAOYSA-N.
| Molecular formula | C16H16O3 |
|---|---|
| Molecular weight | 256.30 g/mol |
| IUPAC name | 2-hydroxy-3-(3-phenylpropyl)benzoic acid |
| InChIKey | VPTXPMBNBZLRET-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCCC2=C(C(=CC=C2)C(=O)O)O |
Computed by PubChem (NCBI)