CAS 93444-91-8 appears in our catalog under these names: 5-Amino-1-(2-chlorobenzyl)-1h-1,2,3-triazole-4-carboxamide, 95%, 5-Amino-1-((2-chlorophenyl)methyl)-1H-1,2,3-triazole-4-carboxamide, 90%, 5-Amino-1-((2-chlorophenyl)methyl)-1H-1,2,3-triazole-4-carboxamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g, 2,5g.
5-amino-1-[(2-chlorophenyl)methyl]triazole-4-carboxamide (CAS 93444-91-8) is a chemical compound with the molecular formula C10H10ClN5O and a molecular weight of 251.67 g/mol. IUPAC name: 5-amino-1-[(2-chlorophenyl)methyl]triazole-4-carboxamide. InChIKey: YNHMYRUNFIQMPN-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN5O |
|---|---|
| Molecular weight | 251.67 g/mol |
| IUPAC name | 5-amino-1-[(2-chlorophenyl)methyl]triazole-4-carboxamide |
| InChIKey | YNHMYRUNFIQMPN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN2C(=C(N=N2)C(=O)N)N)Cl |
Computed by PubChem (NCBI)