CAS 93446-02-7 appears in our catalog under these names: 9-Hydroxy Propantheline Bromide, Propantheline Impurity 1(9-Hydroxy Propantheline Bromide), 9-Hydroxy Propantheline Bromide, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
2-(9-hydroxyxanthene-9-carbonyl)oxyethyl-methyl-di(propan-2-yl)azanium bromide (CAS 93446-02-7) is a chemical compound with the molecular formula C23H30BrNO4 and a molecular weight of 464.4 g/mol. IUPAC name: 2-(9-hydroxyxanthene-9-carbonyl)oxyethyl-methyl-di(propan-2-yl)azanium bromide. InChIKey: RDMADSXCPWAZRH-UHFFFAOYSA-M.
| Molecular formula | C23H30BrNO4 |
|---|---|
| Molecular weight | 464.4 g/mol |
| IUPAC name | 2-(9-hydroxyxanthene-9-carbonyl)oxyethyl-methyl-di(propan-2-yl)azanium bromide |
| InChIKey | RDMADSXCPWAZRH-UHFFFAOYSA-M |
| SMILES | CC(C)[N+](C)(CCOC(=O)C1(C2=CC=CC=C2OC3=CC=CC=C31)O)C(C)C.[Br-] |
Computed by PubChem (NCBI)