CAS 93454-70-7 is the registry number for 8-Perfluorodecyloctane, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-henicosafluorooctadecane (CAS 93454-70-7) is a chemical compound with the molecular formula C18H17F21 and a molecular weight of 632.3 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-henicosafluorooctadecane. InChIKey: QHWFBGRTHMNLGS-UHFFFAOYSA-N.
| Molecular formula | C18H17F21 |
|---|---|
| Molecular weight | 632.3 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-henicosafluorooctadecane |
| InChIKey | QHWFBGRTHMNLGS-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)