CAS 934618-96-9 is the registry number for BDM14471. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2Z)-2-benzylidene-N-[(4-fluorophenyl)methyl]-N'-hydroxypropanediamide (CAS 934618-96-9) is a chemical compound with the molecular formula C17H15FN2O3 and a molecular weight of 314.31 g/mol. IUPAC name: (2Z)-2-benzylidene-N-[(4-fluorophenyl)methyl]-N'-hydroxypropanediamide. InChIKey: HJPWSHCUMPAXLD-GDNBJRDFSA-N.
| Molecular formula | C17H15FN2O3 |
|---|---|
| Molecular weight | 314.31 g/mol |
| IUPAC name | (2Z)-2-benzylidene-N-[(4-fluorophenyl)methyl]-N'-hydroxypropanediamide |
| InChIKey | HJPWSHCUMPAXLD-GDNBJRDFSA-N |
| SMILES | C1=CC=C(C=C1)/C=C(/C(=O)NCC2=CC=C(C=C2)F)\C(=O)NO |
Computed by PubChem (NCBI)