Products 934662-91-6
CAS 934662-91-6 appears in our catalog under these names: Cobimetinib racemate/ 99.71% (existing batch purity), Cobimetinib (racemate), Cobimetinib (racemate), Cobimetinib (racemate), 99.71%, Cobimetinib (racemate) (Standard). Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 2mg, 10mg, 25mg, 5mg, 50mg, 10mM/1mL, 5 mg, 10 mg.
[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-(3-hydroxy-3-piperidin-2-ylazetidin-1-yl)methanone (CAS 934662-91-6) is a chemical compound with the molecular formula C21H21F3IN3O2 and a molecular weight of 531.3 g/mol. IUPAC name: [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-(3-hydroxy-3-piperidin-2-ylazetidin-1-yl)methanone. InChIKey: BSMCAPRUBJMWDF-UHFFFAOYSA-N.
| Molecular formula | C21H21F3IN3O2 |
|---|---|
| Molecular weight | 531.3 g/mol |
| IUPAC name | [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]-(3-hydroxy-3-piperidin-2-ylazetidin-1-yl)methanone |
| InChIKey | BSMCAPRUBJMWDF-UHFFFAOYSA-N |
| SMILES | C1CCNC(C1)C2(CN(C2)C(=O)C3=C(C(=C(C=C3)F)F)NC4=C(C=C(C=C4)I)F)O |
Computed by PubChem (NCBI)