Products 934711-71-4
CAS 934711-71-4 is the registry number for 2-Benzyl 1-(tert-butyl) (2S,5S)-5-hydroxypiperidine-1,2-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-O-benzyl 1-O-tert-butyl (2S,5S)-5-hydroxypiperidine-1,2-dicarboxylate (CAS 934711-71-4) is a chemical compound with the molecular formula C18H25NO5 and a molecular weight of 335.4 g/mol. IUPAC name: 2-O-benzyl 1-O-tert-butyl (2S,5S)-5-hydroxypiperidine-1,2-dicarboxylate. InChIKey: LDTHXGVTMLBBER-GJZGRUSLSA-N.
| Molecular formula | C18H25NO5 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 2-O-benzyl 1-O-tert-butyl (2S,5S)-5-hydroxypiperidine-1,2-dicarboxylate |
| InChIKey | LDTHXGVTMLBBER-GJZGRUSLSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](CC[C@H]1C(=O)OCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)