CAS 934760-93-7 is the registry number for Cis-3,5-dimethyl-1-(4-(trifluoromethoxy)phenyl)piperazine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
(3R,5S)-3,5-dimethyl-1-[4-(trifluoromethoxy)phenyl]piperazine;hydrochloride (CAS 934760-93-7) is a chemical compound with the molecular formula C13H18ClF3N2O and a molecular weight of 310.74 g/mol. IUPAC name: (3R,5S)-3,5-dimethyl-1-[4-(trifluoromethoxy)phenyl]piperazine;hydrochloride. InChIKey: SOGBBPTWYNYKNZ-JMVWIVNTSA-N.
| Molecular formula | C13H18ClF3N2O |
|---|---|
| Molecular weight | 310.74 g/mol |
| IUPAC name | (3R,5S)-3,5-dimethyl-1-[4-(trifluoromethoxy)phenyl]piperazine;hydrochloride |
| InChIKey | SOGBBPTWYNYKNZ-JMVWIVNTSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](N1)C)C2=CC=C(C=C2)OC(F)(F)F.Cl |
Computed by PubChem (NCBI)