CAS 935-77-3 appears in our catalog under these names: (S)-3-Methyl-2,3-dihydro-1H-inden-1-one, 98%, (3S)-3-Methyl-2,3-dihydro-1H-inden-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(3S)-3-methyl-2,3-dihydroinden-1-one (CAS 935-77-3) is a chemical compound with the molecular formula C10H10O and a molecular weight of 146.19 g/mol. IUPAC name: (3S)-3-methyl-2,3-dihydroinden-1-one. InChIKey: XVTQSYKCADSUHN-ZETCQYMHSA-N.
| Molecular formula | C10H10O |
|---|---|
| Molecular weight | 146.19 g/mol |
| IUPAC name | (3S)-3-methyl-2,3-dihydroinden-1-one |
| InChIKey | XVTQSYKCADSUHN-ZETCQYMHSA-N |
| SMILES | C[C@H]1CC(=O)C2=CC=CC=C12 |
Computed by PubChem (NCBI)