CAS 935447-39-5 is the registry number for Sodium 3-fluorobenzene-1-sulfinate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Sodium 3-fluorobenzenesulfinate (CAS 935447-39-5) is a chemical compound with the molecular formula C6H4FNaO2S and a molecular weight of 182.15 g/mol. IUPAC name: sodium 3-fluorobenzenesulfinate. InChIKey: MMBZZYQYBHPSST-UHFFFAOYSA-M.
| Molecular formula | C6H4FNaO2S |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | sodium 3-fluorobenzenesulfinate |
| InChIKey | MMBZZYQYBHPSST-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC(=C1)S(=O)[O-])F.[Na+] |
Computed by PubChem (NCBI)