CAS 935467-97-3 appears in our catalog under these names: Th-237a, 95%, TH-237A, 99+%, TH-237A, TH-237A, 98.55%, 98.55%, TH-237A, 98.55%. Offered by: Combi-blocks, AmBeed, TargetMol, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 2mg, 5mg, 1mg, 10mg, 50mg, 100mg.
[(3R,5S)-3,5-bis(4-fluorophenyl)-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl]methanol (CAS 935467-97-3) is a chemical compound with the molecular formula C18H17F2NO3 and a molecular weight of 333.3 g/mol. IUPAC name: [(3R,5S)-3,5-bis(4-fluorophenyl)-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl]methanol. InChIKey: AEZQGSQEXPUADE-JWTNVVGKSA-N.
| Molecular formula | C18H17F2NO3 |
|---|---|
| Molecular weight | 333.3 g/mol |
| IUPAC name | [(3R,5S)-3,5-bis(4-fluorophenyl)-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl]methanol |
| InChIKey | AEZQGSQEXPUADE-JWTNVVGKSA-N |
| SMILES | C1C2(CO[C@H](N2[C@H](O1)C3=CC=C(C=C3)F)C4=CC=C(C=C4)F)CO |
Computed by PubChem (NCBI)