CAS 93549-15-6 is the registry number for 3,4-Dihydro-6-methoxyisoquinoline Hydrochloride. Offered by: TRC. Available pack sizes: 1g.
6-methoxy-3,4-dihydroisoquinoline;hydrochloride (CAS 93549-15-6) is a chemical compound with the molecular formula C10H12ClNO and a molecular weight of 197.66 g/mol. IUPAC name: 6-methoxy-3,4-dihydroisoquinoline;hydrochloride. InChIKey: GXXXMVHTKNCLFL-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | 6-methoxy-3,4-dihydroisoquinoline;hydrochloride |
| InChIKey | GXXXMVHTKNCLFL-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=NCC2.Cl |
Computed by PubChem (NCBI)