CAS 935519-42-9 is the registry number for 2-(Benzyloxy)-6-(trifluoromethyl)nicotinonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-phenylmethoxy-6-(trifluoromethyl)pyridine-3-carbonitrile (CAS 935519-42-9) is a chemical compound with the molecular formula C14H9F3N2O and a molecular weight of 278.23 g/mol. IUPAC name: 2-phenylmethoxy-6-(trifluoromethyl)pyridine-3-carbonitrile. InChIKey: RCCCAGKAJRJRTG-UHFFFAOYSA-N.
| Molecular formula | C14H9F3N2O |
|---|---|
| Molecular weight | 278.23 g/mol |
| IUPAC name | 2-phenylmethoxy-6-(trifluoromethyl)pyridine-3-carbonitrile |
| InChIKey | RCCCAGKAJRJRTG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC(=N2)C(F)(F)F)C#N |
Computed by PubChem (NCBI)