CAS 935534-39-7 appears in our catalog under these names: 2-Bromo-5-fluoropyridine 1-oxide, 95%, 2-Bromo-5-fluoropyridine 1-oxide 95%, 2-Bromo-5-fluoropyridine 1-oxide, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg.
2-bromo-5-fluoro-1-oxidopyridin-1-ium (CAS 935534-39-7) is a chemical compound with the molecular formula C5H3BrFNO and a molecular weight of 191.99 g/mol. IUPAC name: 2-bromo-5-fluoro-1-oxidopyridin-1-ium. InChIKey: RDZPKTQDXLFGTQ-UHFFFAOYSA-N.
| Molecular formula | C5H3BrFNO |
|---|---|
| Molecular weight | 191.99 g/mol |
| IUPAC name | 2-bromo-5-fluoro-1-oxidopyridin-1-ium |
| InChIKey | RDZPKTQDXLFGTQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=[N+](C=C1F)[O-])Br |
Computed by PubChem (NCBI)