CAS 935666-99-2 appears in our catalog under these names: (1R)–AZD–1480, (1R)-AZD-1480, 97.62%, (1R)-AZD-1480 (Standard). Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 5 mg, 25 mg, 10 mg, 50 mg, 10mM/1mL, Get quote.
5-chloro-2-N-[(1R)-1-(5-fluoropyrimidin-2-yl)ethyl]-4-N-(5-methyl-1H-pyrazol-3-yl)pyrimidine-2,4-diamine (CAS 935666-99-2) is a chemical compound with the molecular formula C14H14ClFN8 and a molecular weight of 348.76 g/mol. IUPAC name: 5-chloro-2-N-[(1R)-1-(5-fluoropyrimidin-2-yl)ethyl]-4-N-(5-methyl-1H-pyrazol-3-yl)pyrimidine-2,4-diamine. InChIKey: PDOQBOJDRPLBQU-MRVPVSSYSA-N.
| Molecular formula | C14H14ClFN8 |
|---|---|
| Molecular weight | 348.76 g/mol |
| IUPAC name | 5-chloro-2-N-[(1R)-1-(5-fluoropyrimidin-2-yl)ethyl]-4-N-(5-methyl-1H-pyrazol-3-yl)pyrimidine-2,4-diamine |
| InChIKey | PDOQBOJDRPLBQU-MRVPVSSYSA-N |
| SMILES | CC1=CC(=NN1)NC2=NC(=NC=C2Cl)N[C@H](C)C3=NC=C(C=N3)F |
Computed by PubChem (NCBI)