CAS 935667-21-3 appears in our catalog under these names: (S)-1-(5-Fluoropyrimidin-2-Yl)Ethanamine Hydrochloride, 98%, 98%, (S)-1-(5-Fluoropyrimidin-2-yl)ethanamine hydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(1S)-1-(5-fluoropyrimidin-2-yl)ethanamine;hydrochloride (CAS 935667-21-3) is a chemical compound with the molecular formula C6H9ClFN3 and a molecular weight of 177.61 g/mol. IUPAC name: (1S)-1-(5-fluoropyrimidin-2-yl)ethanamine;hydrochloride. InChIKey: FAXIYWZAHFHREE-WCCKRBBISA-N.
| Molecular formula | C6H9ClFN3 |
|---|---|
| Molecular weight | 177.61 g/mol |
| IUPAC name | (1S)-1-(5-fluoropyrimidin-2-yl)ethanamine;hydrochloride |
| InChIKey | FAXIYWZAHFHREE-WCCKRBBISA-N |
| SMILES | C[C@@H](C1=NC=C(C=N1)F)N.Cl |
Computed by PubChem (NCBI)