CAS 935683-78-6 is the registry number for (1R,4S)-3,3-Difluoro-4-(hydroxymethyl)cyclopentan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-(1R,4S)-3,3-difluoro-4-(hydroxymethyl)cyclopentan-1-ol (CAS 935683-78-6) is a chemical compound with the molecular formula C6H10F2O2 and a molecular weight of 152.14 g/mol. IUPAC name: cis-(1R,4S)-3,3-difluoro-4-(hydroxymethyl)cyclopentan-1-ol. InChIKey: RJBBODHKJZPREQ-CRCLSJGQSA-N.
| Molecular formula | C6H10F2O2 |
|---|---|
| Molecular weight | 152.14 g/mol |
| IUPAC name | cis-(1R,4S)-3,3-difluoro-4-(hydroxymethyl)cyclopentan-1-ol |
| InChIKey | RJBBODHKJZPREQ-CRCLSJGQSA-N |
| SMILES | C1[C@H](CC([C@@H]1CO)(F)F)O |
Computed by PubChem (NCBI)