CAS 936074-87-2 is the registry number for (2-[1,2,4]Triazolo[3,4-b][1,3,4]thiadiazol-6-ylphenyl)amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)aniline (CAS 936074-87-2) is a chemical compound with the molecular formula C9H7N5S and a molecular weight of 217.25 g/mol. IUPAC name: 2-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)aniline. InChIKey: LXBAPDUJKAIRGJ-UHFFFAOYSA-N.
| Molecular formula | C9H7N5S |
|---|---|
| Molecular weight | 217.25 g/mol |
| IUPAC name | 2-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)aniline |
| InChIKey | LXBAPDUJKAIRGJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NN3C=NN=C3S2)N |
Computed by PubChem (NCBI)