CAS 936083-16-8 is the registry number for 2,4-Dimethyl-5-(piperidin-1-ylsulfonyl)thiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dimethyl-5-piperidin-1-ylsulfonyl-1,3-thiazole (CAS 936083-16-8) is a chemical compound with the molecular formula C10H16N2O2S2 and a molecular weight of 260.4 g/mol. IUPAC name: 2,4-dimethyl-5-piperidin-1-ylsulfonyl-1,3-thiazole. InChIKey: MUUYPJFOHKNNRV-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O2S2 |
|---|---|
| Molecular weight | 260.4 g/mol |
| IUPAC name | 2,4-dimethyl-5-piperidin-1-ylsulfonyl-1,3-thiazole |
| InChIKey | MUUYPJFOHKNNRV-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C)S(=O)(=O)N2CCCCC2 |
Computed by PubChem (NCBI)