CAS 936231-14-0 is the registry number for 5-Methoxy-1-phenyl-1H-indole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g.
5-methoxy-1-phenylindole (CAS 936231-14-0) is a chemical compound with the molecular formula C15H13NO and a molecular weight of 223.27 g/mol. IUPAC name: 5-methoxy-1-phenylindole. InChIKey: OOCUGGYSDYJACZ-UHFFFAOYSA-N.
| Molecular formula | C15H13NO |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | 5-methoxy-1-phenylindole |
| InChIKey | OOCUGGYSDYJACZ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)