CAS 93624-57-8 is the registry number for 2,6-Bis(2,2,2-trifluoroethoxy)benzonitrile, 97%. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 1g.
2,6-bis(2,2,2-trifluoroethoxy)benzonitrile (CAS 93624-57-8) is a chemical compound with the molecular formula C11H7F6NO2 and a molecular weight of 299.17 g/mol. IUPAC name: 2,6-bis(2,2,2-trifluoroethoxy)benzonitrile. InChIKey: YVHZUTZJZUYWBO-UHFFFAOYSA-N.
| Molecular formula | C11H7F6NO2 |
|---|---|
| Molecular weight | 299.17 g/mol |
| IUPAC name | 2,6-bis(2,2,2-trifluoroethoxy)benzonitrile |
| InChIKey | YVHZUTZJZUYWBO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)OCC(F)(F)F)C#N)OCC(F)(F)F |
Computed by PubChem (NCBI)