CAS 936249-23-9 is the registry number for 2-(2,5-Dichloro-3-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2-(2,5-dichloro-3-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 936249-23-9) is a chemical compound with the molecular formula C13H17BCl2O3 and a molecular weight of 303.0 g/mol. IUPAC name: 2-(2,5-dichloro-3-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: MOWKJYXBDNWOSY-UHFFFAOYSA-N.
| Molecular formula | C13H17BCl2O3 |
|---|---|
| Molecular weight | 303.0 g/mol |
| IUPAC name | 2-(2,5-dichloro-3-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | MOWKJYXBDNWOSY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2Cl)OC)Cl |
Computed by PubChem (NCBI)