Products 936450-10-1
CAS 936450-10-1 is the registry number for 1-Methyl-3-(2-(methylthio)ethyl)-1H-imidazol-3-ium chloride, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
1-methyl-3-(2-methylsulfanylethyl)imidazol-1-ium chloride (CAS 936450-10-1) is a chemical compound with the molecular formula C7H13ClN2S and a molecular weight of 192.71 g/mol. IUPAC name: 1-methyl-3-(2-methylsulfanylethyl)imidazol-1-ium chloride. InChIKey: HBCQJHXAHJGEKZ-UHFFFAOYSA-M.
| Molecular formula | C7H13ClN2S |
|---|---|
| Molecular weight | 192.71 g/mol |
| IUPAC name | 1-methyl-3-(2-methylsulfanylethyl)imidazol-1-ium chloride |
| InChIKey | HBCQJHXAHJGEKZ-UHFFFAOYSA-M |
| SMILES | C[N+]1=CN(C=C1)CCSC.[Cl-] |
Computed by PubChem (NCBI)