CAS 936497-79-9 appears in our catalog under these names: 8-O-Benzoyl-hydroxy-quinoline-7-carbaldehyde, 95%, 7-Formylquinolin-8-yl benzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
(7-formylquinolin-8-yl) benzoate (CAS 936497-79-9) is a chemical compound with the molecular formula C17H11NO3 and a molecular weight of 277.27 g/mol. IUPAC name: (7-formylquinolin-8-yl) benzoate. InChIKey: KYZXJWCLXRCVSV-UHFFFAOYSA-N.
| Molecular formula | C17H11NO3 |
|---|---|
| Molecular weight | 277.27 g/mol |
| IUPAC name | (7-formylquinolin-8-yl) benzoate |
| InChIKey | KYZXJWCLXRCVSV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC2=C(C=CC3=C2N=CC=C3)C=O |
Computed by PubChem (NCBI)