CAS 936643-78-6 is the registry number for 7–piperazin–1–yl–Isoquinoline (hydrochloride). Offered by: GLPBio. Available pack sizes: 100mg, 50mg, 500mg.
7-piperazin-1-ylisoquinoline;hydrochloride (CAS 936643-78-6) is a chemical compound with the molecular formula C13H16ClN3 and a molecular weight of 249.74 g/mol. IUPAC name: 7-piperazin-1-ylisoquinoline;hydrochloride. InChIKey: KUTKYDWFMAZEDV-UHFFFAOYSA-N.
| Molecular formula | C13H16ClN3 |
|---|---|
| Molecular weight | 249.74 g/mol |
| IUPAC name | 7-piperazin-1-ylisoquinoline;hydrochloride |
| InChIKey | KUTKYDWFMAZEDV-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC3=C(C=C2)C=CN=C3.Cl |
Computed by PubChem (NCBI)