CAS 936822-38-7 appears in our catalog under these names: 4-[(3,5-Dimethylisoxazol-4-yl)methoxy]benzenesulfonyl chloride, 95%, 4-((3,5-Dimethylisoxazol-4-yl)methoxy)benzene-1-sulfonyl chloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 1g, 10g, 250mg.
4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzenesulfonyl chloride (CAS 936822-38-7) is a chemical compound with the molecular formula C12H12ClNO4S and a molecular weight of 301.75 g/mol. IUPAC name: 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzenesulfonyl chloride. InChIKey: WMBLNQMECZMFNG-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO4S |
|---|---|
| Molecular weight | 301.75 g/mol |
| IUPAC name | 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzenesulfonyl chloride |
| InChIKey | WMBLNQMECZMFNG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)COC2=CC=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)