Products 937-31-5
CAS 937-31-5 appears in our catalog under these names: 4-Nitrophenylacetylene, 1–Ethynyl–4–nitrobenzene, 1-Ethynyl-4-nitrobenzene, >98.0%(GC), 1-Ethynyl-4-nitrobenzene 97%, 1-ETHYNYL-4-NITROBENZENE, 97%. Offered by: TRC, GLPBio, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 1g, 2g, 500mg, 25g, 5g, 500g, 10g, 100g.
1-ethynyl-4-nitrobenzene (CAS 937-31-5) is a chemical compound with the molecular formula C8H5NO2 and a molecular weight of 147.13 g/mol. IUPAC name: 1-ethynyl-4-nitrobenzene. InChIKey: GAZZTEJDUGESGQ-UHFFFAOYSA-N.
| Molecular formula | C8H5NO2 |
|---|---|
| Molecular weight | 147.13 g/mol |
| IUPAC name | 1-ethynyl-4-nitrobenzene |
| InChIKey | GAZZTEJDUGESGQ-UHFFFAOYSA-N |
| SMILES | C#CC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)