CAS 937014-80-7 appears in our catalog under these names: 4-(3-Bromo-benzenesulfonyl)-piperazine-1-carboxylic acid tert-butyl ester, 98%, tert-Butyl 4-((3-bromophenyl)sulfonyl)piperazine-1-carboxylate 98%, 4-(3-Bromo-benzenesulfonyl)-piperazine-1-carboxylic acid tert-butyl ester, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g.
Tert-butyl 4-(3-bromophenyl)sulfonylpiperazine-1-carboxylate (CAS 937014-80-7) is a chemical compound with the molecular formula C15H21BrN2O4S and a molecular weight of 405.3 g/mol. IUPAC name: tert-butyl 4-(3-bromophenyl)sulfonylpiperazine-1-carboxylate. InChIKey: OCPBBZQADAOTDT-UHFFFAOYSA-N.
| Molecular formula | C15H21BrN2O4S |
|---|---|
| Molecular weight | 405.3 g/mol |
| IUPAC name | tert-butyl 4-(3-bromophenyl)sulfonylpiperazine-1-carboxylate |
| InChIKey | OCPBBZQADAOTDT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)S(=O)(=O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)