CAS 937025-17-7 appears in our catalog under these names: 2,5-Dioxopyrrolidin-1-yl 2-oxo-6,9,12,15-tetraoxa-3-thiaoctadecan-18-oate, 98%, 2,5–Dioxopyrrolidin–1–yl 2–oxo–6,9,12,15–tetraoxa–3–thiaoctadecan–18–oate, Ac-S-PEG(4)-NHS, dPEG®,4 SATA (S-Acetyl-dPEG®,4 NHS Ester), dPEG(R)4-SATA 95%. Offered by: AmBeed, GLPBio, Iris Biotech, Biosynth, Chemat. Available pack sizes: 25mg, 5mg, 10mg, 100mg, 1g, 1000mg, 50mg, 250mg.
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(2-acetylsulfanylethoxy)ethoxy]ethoxy]ethoxy]propanoate (CAS 937025-17-7) is a chemical compound with the molecular formula C17H27NO9S and a molecular weight of 421.5 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(2-acetylsulfanylethoxy)ethoxy]ethoxy]ethoxy]propanoate. InChIKey: RIXCZLCOQODDNF-UHFFFAOYSA-N.
| Molecular formula | C17H27NO9S |
|---|---|
| Molecular weight | 421.5 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-(2-acetylsulfanylethoxy)ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | RIXCZLCOQODDNF-UHFFFAOYSA-N |
| SMILES | CC(=O)SCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)