CAS 93703-23-2 is the registry number for 3-Methyl-8-nitro-2,3,6,7-tetrahydro-1H-purine-2,6-dione. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-methyl-8-nitro-7H-purine-2,6-dione (CAS 93703-23-2) is a chemical compound with the molecular formula C6H5N5O4 and a molecular weight of 211.14 g/mol. IUPAC name: 3-methyl-8-nitro-7H-purine-2,6-dione. InChIKey: CUKVQGUXYGJJJX-UHFFFAOYSA-N.
| Molecular formula | C6H5N5O4 |
|---|---|
| Molecular weight | 211.14 g/mol |
| IUPAC name | 3-methyl-8-nitro-7H-purine-2,6-dione |
| InChIKey | CUKVQGUXYGJJJX-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)NC1=O)NC(=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)