CAS 937053-07-1 is the registry number for (1R,2R,4S)-7-Oxabicyclo[2.2.1]heptan-2-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,2R,4S)-7-oxabicyclo[2.2.1]heptan-2-amine (CAS 937053-07-1) is a chemical compound with the molecular formula C6H11NO and a molecular weight of 113.16 g/mol. IUPAC name: (1R,2R,4S)-7-oxabicyclo[2.2.1]heptan-2-amine. InChIKey: DZOONCSMZVPSHJ-KVQBGUIXSA-N.
| Molecular formula | C6H11NO |
|---|---|
| Molecular weight | 113.16 g/mol |
| IUPAC name | (1R,2R,4S)-7-oxabicyclo[2.2.1]heptan-2-amine |
| InChIKey | DZOONCSMZVPSHJ-KVQBGUIXSA-N |
| SMILES | C1C[C@@H]2[C@@H](C[C@H]1O2)N |
Computed by PubChem (NCBI)