CAS 937082-80-9 is the registry number for Poly(9,9-di-(2-ethylhexyl)-fluorenyl-2,7-diyl) end capped with 2,5-diphenyl-1,2,4-oxadiazole. Offered by: Lumtec. Available pack sizes: On request.
Triphenyl-[4-(9-phenylfluoren-9-yl)phenyl]silane (CAS 937082-80-9) is a chemical compound with the molecular formula C43H32Si and a molecular weight of 576.8 g/mol. IUPAC name: triphenyl-[4-(9-phenylfluoren-9-yl)phenyl]silane. InChIKey: HITRWHKLCHWBNZ-UHFFFAOYSA-N.
| Molecular formula | C43H32Si |
|---|---|
| Molecular weight | 576.8 g/mol |
| IUPAC name | triphenyl-[4-(9-phenylfluoren-9-yl)phenyl]silane |
| InChIKey | HITRWHKLCHWBNZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2(C3=CC=CC=C3C4=CC=CC=C42)C5=CC=C(C=C5)[Si](C6=CC=CC=C6)(C7=CC=CC=C7)C8=CC=CC=C8 |
Computed by PubChem (NCBI)