CAS 937188-60-8 appears in our catalog under these names: Ho-peg8-propionic acid, 95%, HO–PEG8–CH2CH2COOH, HO-PEG8-CH2CH2COOH 97%, 3-[(23-Hydroxy-3,6,9,12,15,18,21-heptaoxatricos-1-yl)oxy]propanoic acid, 97%, 97%, HO-PEG8-CH2CH2COOH, 99.93%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5g, 1g, 250mg, 100mg, 10g, 50 mg, 250 mg, 25 mg.
3-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 937188-60-8) is a chemical compound with the molecular formula C19H38O11 and a molecular weight of 442.5 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: BGBLNDCLYGWOKM-UHFFFAOYSA-N.
| Molecular formula | C19H38O11 |
|---|---|
| Molecular weight | 442.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | BGBLNDCLYGWOKM-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCO)C(=O)O |
Computed by PubChem (NCBI)