CAS 937194-99-5 appears in our catalog under these names: Dofetilide Impurity 8, N-Desmethylsulfonyl-N'-methylsulfonyl Dofetilide. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
N-[4-[2-[2-(4-aminophenoxy)ethyl-methylamino]ethyl]phenyl]-N-methylsulfonylmethanesulfonamide (CAS 937194-99-5) is a chemical compound with the molecular formula C19H27N3O5S2 and a molecular weight of 441.6 g/mol. IUPAC name: N-[4-[2-[2-(4-aminophenoxy)ethyl-methylamino]ethyl]phenyl]-N-methylsulfonylmethanesulfonamide. InChIKey: KGQRTKYWLFVGTM-UHFFFAOYSA-N.
| Molecular formula | C19H27N3O5S2 |
|---|---|
| Molecular weight | 441.6 g/mol |
| IUPAC name | N-[4-[2-[2-(4-aminophenoxy)ethyl-methylamino]ethyl]phenyl]-N-methylsulfonylmethanesulfonamide |
| InChIKey | KGQRTKYWLFVGTM-UHFFFAOYSA-N |
| SMILES | CN(CCC1=CC=C(C=C1)N(S(=O)(=O)C)S(=O)(=O)C)CCOC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)