CAS 937195-03-4 appears in our catalog under these names: Dofetilide Impurity 10, N-Methylsulfonyl Dofetilide. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
N-[4-[2-[2-[4-[bis(methylsulfonyl)amino]phenoxy]ethyl-methylamino]ethyl]phenyl]methanesulfonamide (CAS 937195-03-4) is a chemical compound with the molecular formula C20H29N3O7S3 and a molecular weight of 519.7 g/mol. IUPAC name: N-[4-[2-[2-[4-[bis(methylsulfonyl)amino]phenoxy]ethyl-methylamino]ethyl]phenyl]methanesulfonamide. InChIKey: FEVCOGAWNLFSMJ-UHFFFAOYSA-N.
| Molecular formula | C20H29N3O7S3 |
|---|---|
| Molecular weight | 519.7 g/mol |
| IUPAC name | N-[4-[2-[2-[4-[bis(methylsulfonyl)amino]phenoxy]ethyl-methylamino]ethyl]phenyl]methanesulfonamide |
| InChIKey | FEVCOGAWNLFSMJ-UHFFFAOYSA-N |
| SMILES | CN(CCC1=CC=C(C=C1)NS(=O)(=O)C)CCOC2=CC=C(C=C2)N(S(=O)(=O)C)S(=O)(=O)C |
Computed by PubChem (NCBI)