CAS 937275-23-5 appears in our catalog under these names: Montelukast methyl ketone, min. 95 %, 5 mg, Montelukast Impurity F, Montelukast Impurity 6(EP Impurity F), Montelukast Methyl Ketone, >95% (HPLC), Montelukast methyl ketone. Offered by: Roth, Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: 5mg, on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[1-[[(1R)-3-(2-acetylphenyl)-1-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]propyl]sulfanylmethyl]cyclopropyl]acetic acid (CAS 937275-23-5) is a chemical compound with the molecular formula C34H32ClNO3S and a molecular weight of 570.1 g/mol. IUPAC name: 2-[1-[[(1R)-3-(2-acetylphenyl)-1-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]propyl]sulfanylmethyl]cyclopropyl]acetic acid. InChIKey: DYLOVNSFPNMSRY-OTVRWNPNSA-N.
| Molecular formula | C34H32ClNO3S |
|---|---|
| Molecular weight | 570.1 g/mol |
| IUPAC name | 2-[1-[[(1R)-3-(2-acetylphenyl)-1-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]propyl]sulfanylmethyl]cyclopropyl]acetic acid |
| InChIKey | DYLOVNSFPNMSRY-OTVRWNPNSA-N |
| SMILES | CC(=O)C1=CC=CC=C1CC[C@H](C2=CC=CC(=C2)/C=C/C3=NC4=C(C=CC(=C4)Cl)C=C3)SCC5(CC5)CC(=O)O |
Computed by PubChem (NCBI)