CAS 93729-77-2 is the registry number for 10-Acetylphenoxazine-3,7-dioldiacetate. Offered by: Chemat. Available pack sizes: 1g.
(10-acetyl-7-acetyloxyphenoxazin-3-yl) acetate (CAS 93729-77-2) is a chemical compound with the molecular formula C18H15NO6 and a molecular weight of 341.3 g/mol. IUPAC name: (10-acetyl-7-acetyloxyphenoxazin-3-yl) acetate. InChIKey: JOEGJMHVHPYBFW-UHFFFAOYSA-N.
| Molecular formula | C18H15NO6 |
|---|---|
| Molecular weight | 341.3 g/mol |
| IUPAC name | (10-acetyl-7-acetyloxyphenoxazin-3-yl) acetate |
| InChIKey | JOEGJMHVHPYBFW-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C2=C(C=C(C=C2)OC(=O)C)OC3=C1C=CC(=C3)OC(=O)C |
Computed by PubChem (NCBI)