CAS 93747-39-8 appears in our catalog under these names: 3-Amino-2,2,5,7-tetramethyl-2,3-dihydro-1h-inden-4-ol, 95%, 3–Amino–2,2,5,7–tetramethyl–2,3–dihydro–1h–inden–4–ol. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
3-amino-2,2,5,7-tetramethyl-1,3-dihydroinden-4-ol (CAS 93747-39-8) is a chemical compound with the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. IUPAC name: 3-amino-2,2,5,7-tetramethyl-1,3-dihydroinden-4-ol. InChIKey: SILOGAPAAPBBCQ-UHFFFAOYSA-N.
| Molecular formula | C13H19NO |
|---|---|
| Molecular weight | 205.30 g/mol |
| IUPAC name | 3-amino-2,2,5,7-tetramethyl-1,3-dihydroinden-4-ol |
| InChIKey | SILOGAPAAPBBCQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C2=C1CC(C2N)(C)C)O)C |
Computed by PubChem (NCBI)