Products 93753-78-7
CAS 93753-78-7 appears in our catalog under these names: H-Cit-AMC, H–Cit–AMC, H-Cit-AMC trifluoroacetate salt. Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 25mg, 100mg.
(2S)-2-amino-5-(carbamoylamino)-N-(4-methyl-2-oxochromen-7-yl)pentanamide (CAS 93753-78-7) is a chemical compound with the molecular formula C16H20N4O4 and a molecular weight of 332.35 g/mol. IUPAC name: (2S)-2-amino-5-(carbamoylamino)-N-(4-methyl-2-oxochromen-7-yl)pentanamide. InChIKey: WHQBHXDILQZJPU-LBPRGKRZSA-N.
| Molecular formula | C16H20N4O4 |
|---|---|
| Molecular weight | 332.35 g/mol |
| IUPAC name | (2S)-2-amino-5-(carbamoylamino)-N-(4-methyl-2-oxochromen-7-yl)pentanamide |
| InChIKey | WHQBHXDILQZJPU-LBPRGKRZSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@H](CCCNC(=O)N)N |
Computed by PubChem (NCBI)