Products 937597-00-7
CAS 937597-00-7 is the registry number for 2-(2,2-Difluoroethoxy)-5-(trifluoromethyl)aniline, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(2,2-difluoroethoxy)-5-(trifluoromethyl)aniline (CAS 937597-00-7) is a chemical compound with the molecular formula C9H8F5NO and a molecular weight of 241.16 g/mol. IUPAC name: 2-(2,2-difluoroethoxy)-5-(trifluoromethyl)aniline. InChIKey: GZKJIJGPUYSLBO-UHFFFAOYSA-N.
| Molecular formula | C9H8F5NO |
|---|---|
| Molecular weight | 241.16 g/mol |
| IUPAC name | 2-(2,2-difluoroethoxy)-5-(trifluoromethyl)aniline |
| InChIKey | GZKJIJGPUYSLBO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)N)OCC(F)F |
Computed by PubChem (NCBI)