CAS 937606-23-0 is the registry number for 5-Chloro-2-(3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazol-1-yl)aniline, 97%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
5-chloro-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]aniline (CAS 937606-23-0) is a chemical compound with the molecular formula C14H13ClF3N3 and a molecular weight of 315.72 g/mol. IUPAC name: 5-chloro-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]aniline. InChIKey: ZJTRXUYWGCRDFH-UHFFFAOYSA-N.
| Molecular formula | C14H13ClF3N3 |
|---|---|
| Molecular weight | 315.72 g/mol |
| IUPAC name | 5-chloro-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]aniline |
| InChIKey | ZJTRXUYWGCRDFH-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=NN2C3=C(C=C(C=C3)Cl)N)C(F)(F)F |
Computed by PubChem (NCBI)